25117-74-2 4-Ethoxybenzonitrile
| ürün Ad? |
4-Ethoxybenzonitrile |
| ingilizce ad? |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| Moleküler Formülü |
C9H9NO |
| Molekül A??rl??? |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| CAS kay?t numaras? |
25117-74-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.05g/cm3 |
| Kaynama noktas? |
258°C at 760 mmHg |
| K?r?lma indisi |
1.52 |
| Alevlenme noktas? |
110.9°C |
| Buhar bas?nc? |
0.0141mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|