25117-74-2 4-Ethoxybenzonitrile
| Nazwa produktu: |
4-Ethoxybenzonitrile |
| Angielska nazwa |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| MF |
C9H9NO |
| Masie cz?steczkowej |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| Nr CAS |
25117-74-2 |
| Struktury molekularnej |
|
| G?sto?? |
1.05g/cm3 |
| Temperatura wrzenia |
258°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.52 |
| Temperatura zap?onu |
110.9°C |
| Ci?nienie pary |
0.0141mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|