25117-74-2 4-Ethoxybenzonitrile
| Ονομασ?α του προ??ντο? |
4-Ethoxybenzonitrile |
| Αγγλικ? ?νομα |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| MF |
C9H9NO |
| Μοριακ? β?ρο? |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| CAS ΟΧΙ |
25117-74-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.05g/cm3 |
| Σημε?ο βρασμο? |
258°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.52 |
| Σημε?ο αν?φλεξη? |
110.9°C |
| Π?εση ατμ?ν |
0.0141mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|