25117-74-2 4-Ethoxybenzonitrile
| Nom |
4-Ethoxybenzonitrile |
| Nom anglais |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| Formule moléculaire |
C9H9NO |
| Poids Moléculaire |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| Numéro de registre CAS |
25117-74-2 |
| Structure moléculaire |
|
| Densité |
1.05g/cm3 |
| Point d'ébullition |
258°C at 760 mmHg |
| Indice de réfraction |
1.52 |
| Point d'éclair |
110.9°C |
| Pression de vapeur |
0.0141mmHg at 25°C |
| Codes des risques |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Description de sécurité |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|