25117-74-2 4-Ethoxybenzonitrile
| název vyrobku |
4-Ethoxybenzonitrile |
| Anglicky název |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| Molekulární vzorec |
C9H9NO |
| Molekulová hmotnost |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| Registra?ní ?íslo CAS |
25117-74-2 |
| Molekulární struktura |
|
| Hustota |
1.05g/cm3 |
| Bod varu |
258°C at 760 mmHg |
| Index lomu |
1.52 |
| Bod vzplanutí |
110.9°C |
| Tlak par |
0.0141mmHg at 25°C |
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|