25117-74-2 4-Ethoxybenzonitrile
| termék neve |
4-Ethoxybenzonitrile |
| Angol név |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| MF |
C9H9NO |
| Molekulat?meg |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| CAS-szám |
25117-74-2 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.05g/cm3 |
| Forráspont |
258°C at 760 mmHg |
| T?résmutató |
1.52 |
| Gyulladáspont |
110.9°C |
| G?znyomás |
0.0141mmHg at 25°C |
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|