25117-74-2 4-Ethoxybenzonitrile
| Nome do produto |
4-Ethoxybenzonitrile |
| Nome em inglês |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| Fórmula molecular |
C9H9NO |
| Peso Molecular |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| CAS Registry Number |
25117-74-2 |
| Estrutura Molecular |
|
| Densidade |
1.05g/cm3 |
| Ponto de ebuli??o |
258°C at 760 mmHg |
| índice de refra??o |
1.52 |
| O ponto de inflama??o |
110.9°C |
| Press?o de vapor |
0.0141mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|