1732-08-7 Dimethyl pimelate
| ürün Ad? |
Dimethyl pimelate |
| ingilizce ad? |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| Moleküler Formülü |
C9H16O4 |
| Molekül A??rl??? |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| CAS kay?t numaras? |
1732-08-7 |
| EINECS |
217-057-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.022g/cm3 |
| Kaynama noktas? |
250.3°C at 760 mmHg |
| K?r?lma indisi |
1.427 |
| Alevlenme noktas? |
105.4°C |
| Buhar bas?nc? |
0.0219mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|