1732-08-7 Dimethyl pimelate
| Nama produk |
Dimethyl pimelate |
| Nama Inggeris |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| MF |
C9H16O4 |
| Berat Molekul |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| CAS NO |
1732-08-7 |
| EINECS |
217-057-4 |
| Struktur Molekul |
|
| Kepadatan |
1.022g/cm3 |
| Titik didih |
250.3°C at 760 mmHg |
| Indeks bias |
1.427 |
| Titik nyala |
105.4°C |
| Tekanan wap |
0.0219mmHg at 25°C |
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|