1732-08-7 Dimethyl pimelate
| Nazwa produktu: |
Dimethyl pimelate |
| Angielska nazwa |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| MF |
C9H16O4 |
| Masie cz?steczkowej |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| Nr CAS |
1732-08-7 |
| EINECS |
217-057-4 |
| Struktury molekularnej |
|
| G?sto?? |
1.022g/cm3 |
| Temperatura wrzenia |
250.3°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.427 |
| Temperatura zap?onu |
105.4°C |
| Ci?nienie pary |
0.0219mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|