4187-86-4 Ethyl ethynyl carbinol
| produktnavn |
Ethyl ethynyl carbinol |
| Engelsk navn |
Ethyl ethynyl carbinol; 1-Pentyn-3-ol, (Ethyl ethynyl carbinol); 1-Pentyn-3-ol; pent-1-yn-3-ol; (3R)-pent-1-yn-3-ol; (3S)-pent-1-yn-3-ol |
| Molekyl?r Formel |
C5H8O |
| Molekylvekt |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-5(6)4-2/h1,5-6H,4H2,2H3/t5-/m1/s1 |
| CAS-nummer |
4187-86-4 |
| EINECS |
224-063-0 |
| Molecular Structure |
|
| Tetthet |
0.907g/cm3 |
| Kokepunkt |
126.9°C at 760 mmHg |
| Brytningsindeks |
1.442 |
| Flammepunktet |
29.4°C |
| Damptrykk |
5.24mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|