4187-86-4 Ethyl ethynyl carbinol
| ?????? ?? ??? |
Ethyl ethynyl carbinol |
| ???????? ??? |
Ethyl ethynyl carbinol; 1-Pentyn-3-ol, (Ethyl ethynyl carbinol); 1-Pentyn-3-ol; pent-1-yn-3-ol; (3R)-pent-1-yn-3-ol; (3S)-pent-1-yn-3-ol |
| ????? ???????? |
C5H8O |
| ?????? ??? |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-5(6)4-2/h1,5-6H,4H2,2H3/t5-/m1/s1 |
| ??? ??????? ?????? |
4187-86-4 |
| EINECS |
224-063-0 |
| ????? ?????? |
|
| ????? |
0.907g/cm3 |
| ????? ?? ??? |
126.9°C at 760 mmHg |
| ??????? ??????? |
1.442 |
| ????? ??????? |
29.4°C |
| ????? ?? ???? |
5.24mmHg at 25°C |
| ???? ?????? |
Xi:Irritant;
|
| ???? ?? ??? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|