4187-86-4 Ethyl ethynyl carbinol
| Nome del prodotto |
Ethyl ethynyl carbinol |
| Nome inglese |
Ethyl ethynyl carbinol; 1-Pentyn-3-ol, (Ethyl ethynyl carbinol); 1-Pentyn-3-ol; pent-1-yn-3-ol; (3R)-pent-1-yn-3-ol; (3S)-pent-1-yn-3-ol |
| Formula molecolare |
C5H8O |
| Peso Molecolare |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-5(6)4-2/h1,5-6H,4H2,2H3/t5-/m1/s1 |
| Numero CAS |
4187-86-4 |
| EINECS |
224-063-0 |
| Struttura molecolare |
|
| Densità |
0.907g/cm3 |
| Punto di ebollizione |
126.9°C at 760 mmHg |
| Indice di rifrazione |
1.442 |
| Punto d'infiammabilità |
29.4°C |
| Pressione di vapore |
5.24mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|