5326-38-5 2-Iodo-5-nitrotoluene
| Nome del prodotto |
2-Iodo-5-nitrotoluene |
| Nome inglese |
2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
| Formula molecolare |
C16H15N3O |
| Peso Molecolare |
265.3098 |
| InChI |
InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| Numero CAS |
5326-38-5 |
| EINECS |
226-204-1 |
| Struttura molecolare |
|
| Densità |
1.217g/cm3 |
| Punto di ebollizione |
531.5°C at 760 mmHg |
| Indice di rifrazione |
1.665 |
| Punto d'infiammabilità |
275.2°C |
| Pressione di vapore |
2.23E-11mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|