5326-38-5 2-Iodo-5-nitrotoluene
| Nama produk |
2-Iodo-5-nitrotoluene |
| Nama bahasa Inggris |
2-Iodo-5-nitrotoluene;1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
| MF |
C16H15N3O |
| Berat Molekul |
265.3098 |
| InChI |
InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| CAS NO |
5326-38-5 |
| EINECS |
226-204-1 |
| Struktur Molekul |
|
| Kepadatan |
1.217g/cm3 |
| Titik didih |
531.5°C at 760 mmHg |
| Indeks bias |
1.665 |
| Titik nyala |
275.2°C |
| Tekanan uap |
2.23E-11mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|