5326-38-5 2-Iodo-5-nitrotoluene
| product Name |
2-Iodo-5-nitrotoluene |
| CAS No |
5326-38-5 |
| Synonyms |
1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
| Molecular Formula |
C16H15N3O |
| Molecular Weight |
265.3098 |
| InChI |
InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
| EINECS |
226-204-1 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Boiling point |
531.5°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
275.2°C |
| Vapour Pressur |
2.23E-11mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |