623-51-8 Ethyl 2-mercaptoacetate
| ?? ????? |
Ethyl 2-mercaptoacetate |
| ?? ????? |
Ethyl 2-mercaptoacetate; Ethyl thioglycolate; Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
| ????????? ??????? |
C4H8O2S |
| ???? ???????? |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
| ???? CAS |
623-51-8 |
| EINECS |
210-800-3 |
| ???? ???????? |
|
| ?????? |
1.072g/cm3 |
| ????? ????? |
157.8°C at 760 mmHg |
| ???? ????? |
1.452 |
| ????? ???? |
47.8°C |
| ??? ???? |
2.7mmHg at 25°C |
| Hazard ?????? |
T:Toxic;
|
| ??????? ???? |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| ?????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|