623-51-8 Ethyl 2-mercaptoacetate
| product Name |
Ethyl 2-mercaptoacetate |
| CAS No |
623-51-8 |
| Synonyms |
Ethyl thioglycolate; Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
| Molecular Formula |
C4H8O2S |
| Molecular Weight |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
| EINECS |
210-800-3 |
| Molecular Structure |
|
| Density |
1.072g/cm3 |
| Boiling point |
157.8°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
47.8°C |
| Vapour Pressur |
2.7mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Description |
Molecular formula: HSCH2COOC2H5 Specification: | Specification | Property | | Appearance | Bright and clear | | Purity | 99% | | Density??20?棩 | 1.100??1.110 | ?? gas chromatograph Usage: Medicine intermediate Package: 200 L plastic drum, 220Kg/drum, net |
| Contact |
qianjin yi |
| Telephone |
+86-535-5203189 5203569 |
| Email |
aotongchem@188.com |
| Address |
xishou minsheng road,qixia ShanDong P.R.CHINA |