623-51-8 Ethyl 2-mercaptoacetate
| Produkt-Name |
Ethyl 2-mercaptoacetate |
| Englischer Name |
Ethyl 2-mercaptoacetate; Ethyl thioglycolate; Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
| Molekulare Formel |
C4H8O2S |
| Molecular Weight |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
| CAS Registry Number |
623-51-8 |
| EINECS |
210-800-3 |
| Molecular Structure |
|
| Dichte |
1.072g/cm3 |
| Siedepunkt |
157.8°C at 760 mmHg |
| Brechungsindex |
1.452 |
| Flammpunkt |
47.8°C |
| Dampfdruck |
2.7mmHg at 25°C |
| Gefahrensymbole |
T:Toxic;
|
| Risk Codes |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|