4160-51-4 4'-methoxybutyrophenone
| ürün Ad? |
4'-methoxybutyrophenone |
| ingilizce ad? |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
| Moleküler Formülü |
C11H14O2 |
| Molekül A??rl??? |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| CAS kay?t numaras? |
4160-51-4 |
| EINECS |
223-995-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.001g/cm3 |
| Kaynama noktas? |
288.3°C at 760 mmHg |
| K?r?lma indisi |
1.498 |
| Alevlenme noktas? |
124.3°C |
| Buhar bas?nc? |
0.00236mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|