4160-51-4 4'-methoxybutyrophenone
| Nome do produto |
4'-methoxybutyrophenone |
| Nome em inglês |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
| Fórmula molecular |
C11H14O2 |
| Peso Molecular |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
4160-51-4 |
| EINECS |
223-995-5 |
| Estrutura Molecular |
|
| Densidade |
1.001g/cm3 |
| Ponto de ebuli??o |
288.3°C at 760 mmHg |
| índice de refra??o |
1.498 |
| O ponto de inflama??o |
124.3°C |
| Press?o de vapor |
0.00236mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|