ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
| Nome do produto |
1-(3-fluorophenyl)ethanol |
| Nome em inglês |
1-(3-fluorophenyl)ethanol; 3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
| Fórmula molecular |
C8H9FO |
| Peso Molecular |
140.1549 |
| InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| CAS Registry Number |
402-63-1 |
| EINECS |
206-950-4 |
| Estrutura Molecular |
|
| Densidade |
1.123g/cm3 |
| Ponto de ebuli??o |
196.2°C at 760 mmHg |
| índice de refra??o |
1.51 |
| O ponto de inflama??o |
90.1°C |
| Press?o de vapor |
0.251mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|