ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
| Nama produk |
1-(3-fluorophenyl)ethanol |
| Nama bahasa Inggris |
1-(3-fluorophenyl)ethanol; 3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
| MF |
C8H9FO |
| Berat Molekul |
140.1549 |
| InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
| CAS NO |
402-63-1 |
| EINECS |
206-950-4 |
| Struktur Molekul |
|
| Kepadatan |
1.123g/cm3 |
| Titik didih |
196.2°C at 760 mmHg |
| Indeks bias |
1.51 |
| Titik nyala |
90.1°C |
| Tekanan uap |
0.251mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|