ChemNet > CAS > 7560-44-3 Methyl 4-chlorocinnamate
7560-44-3 Methyl 4-chlorocinnamate
| produktnavn |
Methyl 4-chlorocinnamate |
| Engelsk navn |
Methyl 4-chlorocinnamate; 4-Chlorocinnamic acid methyl ester; methyl 3-(4-chlorophenyl)prop-2-enoate; methyl (2E)-3-(4-chlorophenyl)prop-2-enoate |
| Molekyl?r Formel |
C10H9ClO2 |
| Molekylvekt |
196.6303 |
| InChI |
InChI=1/C10H9ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+ |
| CAS-nummer |
7560-44-3 |
| EINECS |
231-451-3 |
| Molecular Structure |
|
| Tetthet |
1.211g/cm3 |
| Smeltepunkt |
76-77℃ |
| Kokepunkt |
292.8°C at 760 mmHg |
| Brytningsindeks |
1.572 |
| Flammepunktet |
144.4°C |
| Damptrykk |
0.0018mmHg at 25°C |
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|