ChemNet > CAS > 7560-44-3 Methyl 4-chlorocinnamate
7560-44-3 Methyl 4-chlorocinnamate
| Naam product |
Methyl 4-chlorocinnamate |
| Engelse naam |
Methyl 4-chlorocinnamate; 4-Chlorocinnamic acid methyl ester; methyl 3-(4-chlorophenyl)prop-2-enoate; methyl (2E)-3-(4-chlorophenyl)prop-2-enoate |
| MF |
C10H9ClO2 |
| Molecuulgewicht |
196.6303 |
| InChI |
InChI=1/C10H9ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+ |
| CAS-nummer |
7560-44-3 |
| EINECS |
231-451-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.211g/cm3 |
| Smeltpunt |
76-77℃ |
| Kookpunt |
292.8°C at 760 mmHg |
| Brekingsindex |
1.572 |
| Vlampunt |
144.4°C |
| Dampdruk |
0.0018mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|