65610-14-2 4-Fluorophthalonitrile
| Naam product |
4-Fluorophthalonitrile |
| Engelse naam |
4-Fluorophthalonitrile; 4-Fluorophthalodinitrile; 1,2-Dicyano-4-Fluorobenzene; 4-Fluorobenzene-1,2-Dicarbonitrile; 4-fluoro-1,2-benzenedicarbonitrile; 4-fluoro-2-benzenedicarbonitrile; 1,2-Benzenedicarbonitrile,4-fluoro-; 4-Fluorobenzene-1,2-dicarbonitrile; 4-Fluorobenzene-1,2-dinitrile; 4-Fluorophthalonitrle |
| MF |
C8H3FN2 |
| Molecuulgewicht |
146.1212 |
| InChI |
InChI=1/C8H3FN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H |
| CAS-nummer |
65610-14-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.27g/cm3 |
| Smeltpunt |
100-102℃ |
| Kookpunt |
303.7°C at 760 mmHg |
| Brekingsindex |
1.538 |
| Vlampunt |
137.5°C |
| Dampdruk |
0.000917mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|