65610-14-2 4-Fluorophthalonitrile
| product Name |
4-Fluorophthalonitrile |
| CAS No |
65610-14-2 |
| Synonyms |
4-Fluorophthalodinitrile; 1,2-Dicyano-4-Fluorobenzene; 4-Fluorobenzene-1,2-Dicarbonitrile; 4-fluoro-1,2-benzenedicarbonitrile; 4-fluoro-2-benzenedicarbonitrile; 1,2-Benzenedicarbonitrile,4-fluoro-; 4-Fluorobenzene-1,2-dicarbonitrile; 4-Fluorobenzene-1,2-dinitrile; 4-Fluorophthalonitrle |
| Molecular Formula |
C8H3FN2 |
| Molecular Weight |
146.1212 |
| InChI |
InChI=1/C8H3FN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Melting point |
100-102℃ |
| Boiling point |
303.7°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
137.5°C |
| Vapour Pressur |
0.000917mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |
| Contact |
Frank Zhang |
| Telephone |
+86-571-85586753;+86-13336034509 |
| Email |
sales@fluoropharm.com |
| Address |
No.88 Jiangling RD,Xixing Street,Binjiang District,Hangzhou,Zhejiang,310051,China |