ChemNet > CAS > 614-57-3 Cinnamylideneacetophenone
614-57-3 Cinnamylideneacetophenone
| Naam product |
Cinnamylideneacetophenone |
| Engelse naam |
Cinnamylideneacetophenone; 5-phenylpenta-2,4-dienophenone; 1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone; 1,5-diphenylpenta-2,4-dien-1-one; (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
| MF |
C17H14O |
| Molecuulgewicht |
234.2925 |
| InChI |
InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
| CAS-nummer |
614-57-3 |
| EINECS |
210-385-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.082g/cm3 |
| Smeltpunt |
100-102℃ |
| Kookpunt |
388.1°C at 760 mmHg |
| Brekingsindex |
1.624 |
| Vlampunt |
169.6°C |
| Dampdruk |
3.15E-06mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|