ChemNet > CAS > 614-57-3 Cinnamylideneacetophenone
614-57-3 Cinnamylideneacetophenone
| Ονομασ?α του προ??ντο? |
Cinnamylideneacetophenone |
| Αγγλικ? ?νομα |
Cinnamylideneacetophenone; 5-phenylpenta-2,4-dienophenone; 1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone; 1,5-diphenylpenta-2,4-dien-1-one; (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
| MF |
C17H14O |
| Μοριακ? β?ρο? |
234.2925 |
| InChI |
InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
| CAS ΟΧΙ |
614-57-3 |
| EINECS |
210-385-9 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.082g/cm3 |
| Σημε?ο τ?ξη? |
100-102℃ |
| Σημε?ο βρασμο? |
388.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.624 |
| Σημε?ο αν?φλεξη? |
169.6°C |
| Π?εση ατμ?ν |
3.15E-06mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|