4938-52-7 1-Hepten-3-ol
| Naam product |
1-Hepten-3-ol |
| Engelse naam |
1-Hepten-3-ol; n-Butyl vinyl carbinol; hept-1-en-3-ol; (3S)-hept-1-en-3-ol |
| MF |
C7H14O |
| Molecuulgewicht |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-3-5-6-7(8)4-2/h4,7-8H,2-3,5-6H2,1H3/t7-/m1/s1 |
| CAS-nummer |
4938-52-7 |
| EINECS |
225-579-9 |
| Moleculaire Structuur |
|
| Dichtheid |
0.833g/cm3 |
| Kookpunt |
154.5°C at 760 mmHg |
| Brekingsindex |
1.434 |
| Vlampunt |
48.8°C |
| Dampdruk |
1.16mmHg at 25°C |
| Risico-codes |
R10:Flammable.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|