4938-52-7 1-Hepten-3-ol
| Produkt-Name |
1-Hepten-3-ol |
| Englischer Name |
1-Hepten-3-ol; n-Butyl vinyl carbinol; hept-1-en-3-ol; (3S)-hept-1-en-3-ol |
| Molekulare Formel |
C7H14O |
| Molecular Weight |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-3-5-6-7(8)4-2/h4,7-8H,2-3,5-6H2,1H3/t7-/m1/s1 |
| CAS Registry Number |
4938-52-7 |
| EINECS |
225-579-9 |
| Molecular Structure |
|
| Dichte |
0.833g/cm3 |
| Siedepunkt |
154.5°C at 760 mmHg |
| Brechungsindex |
1.434 |
| Flammpunkt |
48.8°C |
| Dampfdruck |
1.16mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|