ChemNet > CAS > 3198-15-0 Norephedrine hydrochloride
3198-15-0 Norephedrine hydrochloride
| Naam product |
Norephedrine hydrochloride |
| Engelse naam |
Norephedrine hydrochloride; Phenylpropanolamine hydrochloride; 2-Amino-1-phenyl-1-propanol hydrochloride; 2-amino-1-phenylpropan-1-ol |
| MF |
C9H13NO |
| Molecuulgewicht |
151.2056 |
| InChI |
InChI=1/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
| CAS-nummer |
3198-15-0 |
| EINECS |
221-702-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.071g/cm3 |
| Smeltpunt |
194-197℃ |
| Kookpunt |
288.1°C at 760 mmHg |
| Brekingsindex |
1.557 |
| Vlampunt |
128.1°C |
| Dampdruk |
0.0011mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R22:Harmful if swallowed.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|