ChemNet > CAS > 3198-15-0 Norephedrine hydrochloride
3198-15-0 Norephedrine hydrochloride
| Produkt-Name |
Norephedrine hydrochloride |
| Englischer Name |
Norephedrine hydrochloride; Phenylpropanolamine hydrochloride; 2-Amino-1-phenyl-1-propanol hydrochloride; 2-amino-1-phenylpropan-1-ol |
| Molekulare Formel |
C9H13NO |
| Molecular Weight |
151.2056 |
| InChI |
InChI=1/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
| CAS Registry Number |
3198-15-0 |
| EINECS |
221-702-5 |
| Molecular Structure |
|
| Dichte |
1.071g/cm3 |
| Schmelzpunkt |
194-197℃ |
| Siedepunkt |
288.1°C at 760 mmHg |
| Brechungsindex |
1.557 |
| Flammpunkt |
128.1°C |
| Dampfdruck |
0.0011mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|