5396-71-4 Ethyl 3-nitrocinnamate
| Nome del prodotto |
Ethyl 3-nitrocinnamate |
| Nome inglese |
Ethyl 3-nitrocinnamate; 3-Nitrocinnamic acid ethyl ester; 2-{[2-chloro-5-(morpholin-4-ylsulfonyl)phenyl]amino}-2-oxoethyl pyrazine-2-carboxylate; ethyl (2E)-3-(3-nitrophenyl)prop-2-enoate |
| Formula molecolare |
C11H11NO4 |
| Peso Molecolare |
221.2093 |
| InChI |
InChI=1/C11H11NO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8H,2H2,1H3/b7-6+ |
| Numero CAS |
5396-71-4 |
| EINECS |
226-415-9 |
| Struttura molecolare |
|
| Densità |
1.237g/cm3 |
| Punto di fusione |
73-75℃ |
| Punto di ebollizione |
346.7°C at 760 mmHg |
| Indice di rifrazione |
1.582 |
| Punto d'infiammabilità |
154.5°C |
| Pressione di vapore |
5.65E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|