5396-71-4 Ethyl 3-nitrocinnamate
| Ονομασ?α του προ??ντο? |
Ethyl 3-nitrocinnamate |
| Αγγλικ? ?νομα |
Ethyl 3-nitrocinnamate; 3-Nitrocinnamic acid ethyl ester; 2-{[2-chloro-5-(morpholin-4-ylsulfonyl)phenyl]amino}-2-oxoethyl pyrazine-2-carboxylate; ethyl (2E)-3-(3-nitrophenyl)prop-2-enoate |
| MF |
C11H11NO4 |
| Μοριακ? β?ρο? |
221.2093 |
| InChI |
InChI=1/C11H11NO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8H,2H2,1H3/b7-6+ |
| CAS ΟΧΙ |
5396-71-4 |
| EINECS |
226-415-9 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.237g/cm3 |
| Σημε?ο τ?ξη? |
73-75℃ |
| Σημε?ο βρασμο? |
346.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.582 |
| Σημε?ο αν?φλεξη? |
154.5°C |
| Π?εση ατμ?ν |
5.65E-05mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|