ChemNet > CAS > 4884-24-6 Cyclopentylcyclopentanon
4884-24-6 Cyclopentylcyclopentanon
| Nome del prodotto |
Cyclopentylcyclopentanon |
| Nome inglese |
Cyclopentylcyclopentanon; 2-Cyclopentylcyclopentanone; 1,1'-bi(cyclopentyl)-2-one |
| Formula molecolare |
C10H16O |
| Peso Molecolare |
152.2334 |
| InChI |
InChI=1/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2 |
| Numero CAS |
4884-24-6 |
| EINECS |
225-495-2 |
| Struttura molecolare |
|
| Densità |
1.031g/cm3 |
| Punto di ebollizione |
232.5°C at 760 mmHg |
| Indice di rifrazione |
1.512 |
| Punto d'infiammabilità |
90.3°C |
| Pressione di vapore |
0.0588mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|