ChemNet > CAS > 4884-24-6 Cyclopentylcyclopentanon
4884-24-6 Cyclopentylcyclopentanon
| Nama produk |
Cyclopentylcyclopentanon |
| Nama bahasa Inggris |
Cyclopentylcyclopentanon; 2-Cyclopentylcyclopentanone; 1,1'-bi(cyclopentyl)-2-one |
| MF |
C10H16O |
| Berat Molekul |
152.2334 |
| InChI |
InChI=1/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2 |
| CAS NO |
4884-24-6 |
| EINECS |
225-495-2 |
| Struktur Molekul |
|
| Kepadatan |
1.031g/cm3 |
| Titik didih |
232.5°C at 760 mmHg |
| Indeks bias |
1.512 |
| Titik nyala |
90.3°C |
| Tekanan uap |
0.0588mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|