10354-00-4 dibenzosuberenol
| Nome del prodotto |
dibenzosuberenol |
| Nome inglese |
dibenzosuberenol; dibenzo(b,f)cyclohepten-1-ol; 5H-Dibenzo[a,d]cyclohepten-5-ol; Dibenzo[b,f]cyclohepten-1-ol; 5H-dibenzo[a,d][7]annulen-5-ol |
| Formula molecolare |
C15H12O |
| Peso Molecolare |
208.2552 |
| InChI |
InChI=1/C15H12O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15-16H |
| Numero CAS |
10354-00-4 |
| EINECS |
233-774-5 |
| Struttura molecolare |
|
| Densità |
1.196g/cm3 |
| Punto di fusione |
122.5-124℃ |
| Punto di ebollizione |
401.9°C at 760 mmHg |
| Indice di rifrazione |
1.659 |
| Punto d'infiammabilità |
147.6°C |
| Pressione di vapore |
3.52E-07mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|