10354-00-4 dibenzosuberenol
| Produkt-Name |
dibenzosuberenol |
| Englischer Name |
dibenzosuberenol; dibenzo(b,f)cyclohepten-1-ol; 5H-Dibenzo[a,d]cyclohepten-5-ol; Dibenzo[b,f]cyclohepten-1-ol; 5H-dibenzo[a,d][7]annulen-5-ol |
| Molekulare Formel |
C15H12O |
| Molecular Weight |
208.2552 |
| InChI |
InChI=1/C15H12O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15-16H |
| CAS Registry Number |
10354-00-4 |
| EINECS |
233-774-5 |
| Molecular Structure |
|
| Dichte |
1.196g/cm3 |
| Schmelzpunkt |
122.5-124℃ |
| Siedepunkt |
401.9°C at 760 mmHg |
| Brechungsindex |
1.659 |
| Flammpunkt |
147.6°C |
| Dampfdruck |
3.52E-07mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|