38291-82-6 Valeric acid hydrazide
| Ονομασ?α του προ??ντο? |
Valeric acid hydrazide |
| Αγγλικ? ?νομα |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
| MF |
C5H12N2O |
| Μοριακ? β?ρο? |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| CAS ΟΧΙ |
38291-82-6 |
| EINECS |
253-864-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.962g/cm3 |
| Σημε?ο βρασμο? |
260.6°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.449 |
| Σημε?ο αν?φλεξη? |
111.4°C |
| Π?εση ατμ?ν |
0.0122mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|