38291-82-6 Valeric acid hydrazide
| Nom |
Valeric acid hydrazide |
| Nom anglais |
Valeric acid hydrazide; Pentanoic acid hydrazide; pentanehydrazide |
| Formule moléculaire |
C5H12N2O |
| Poids Moléculaire |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
| Numéro de registre CAS |
38291-82-6 |
| EINECS |
253-864-8 |
| Structure moléculaire |
|
| Densité |
0.962g/cm3 |
| Point d'ébullition |
260.6°C at 760 mmHg |
| Indice de réfraction |
1.449 |
| Point d'éclair |
111.4°C |
| Pression de vapeur |
0.0122mmHg at 25°C |
| Codes des risques |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|