39593-08-3 Methylphenylpiperazine
| ürün Ad? |
Methylphenylpiperazine |
| ingilizce ad? |
Methylphenylpiperazine; 1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
| Moleküler Formülü |
C11H16N2 |
| Molekül A??rl??? |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| CAS kay?t numaras? |
39593-08-3 |
| EINECS |
254-534-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.012g/cm3 |
| Kaynama noktas? |
321.2°C at 760 mmHg |
| K?r?lma indisi |
1.54 |
| Alevlenme noktas? |
153.8°C |
| Buhar bas?nc? |
0.000303mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|