2307-10-0 S-n-Propyl thioacetate
| ürün Ad? |
S-n-Propyl thioacetate |
| ingilizce ad? |
S-n-Propyl thioacetate; Thioacetic acid S-n-propyl ester; S-propyl ethanethioate; Propyl thioacetate; Normal-propyl thioacetate |
| Moleküler Formülü |
C5H10OS |
| Molekül A??rl??? |
118.1973 |
| InChI |
InChI=1/C5H10OS/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
| CAS kay?t numaras? |
2307-10-0 |
| EINECS |
218-984-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.967g/cm3 |
| Kaynama noktas? |
141.4°C at 760 mmHg |
| K?r?lma indisi |
1.456 |
| Alevlenme noktas? |
36°C |
| Buhar bas?nc? |
5.87mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|