10487-71-5 Crotonyl chloride
| ürün Ad? |
Crotonyl chloride |
| ingilizce ad? |
Crotonyl chloride; 2-Butenoyl chloride; But-2-enoyl chloride |
| Moleküler Formülü |
C4H5ClO |
| Molekül A??rl??? |
104.5349 |
| InChI |
InChI=1/C4H5ClO/c1-2-3-4(5)6/h2-3H,1H3/b3-2- |
| CAS kay?t numaras? |
10487-71-5 |
| EINECS |
234-010-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.081g/cm3 |
| Kaynama noktas? |
124.499°C at 760 mmHg |
| K?r?lma indisi |
1.441 |
| Alevlenme noktas? |
35°C |
| Buhar bas?nc? |
12.707mmHg at 25°C |
| Tehlike Sembolleri |
C:Corrosive;
|
| Risk Kodlar? |
R10:Flammable.;
R34:Causes burns.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|