ChemNet > CAS > 4166-53-4 3-Methylglutaric anhydride
4166-53-4 3-Methylglutaric anhydride
| Naam product |
3-Methylglutaric anhydride |
| Engelse naam |
3-Methylglutaric anhydride; 4-methyldihydro-2H-pyran-2,6(3H)-dione |
| MF |
C6H8O3 |
| Molecuulgewicht |
128.1259 |
| InChI |
InChI=1/C6H8O3/c1-4-2-5(7)9-6(8)3-4/h4H,2-3H2,1H3 |
| CAS-nummer |
4166-53-4 |
| EINECS |
224-020-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.159g/cm3 |
| Smeltpunt |
40-45℃ |
| Kookpunt |
299.5°C at 760 mmHg |
| Brekingsindex |
1.448 |
| Vlampunt |
113°C |
| Dampdruk |
0.00119mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|