4906-24-5 3-Acetoxy-2-butanone
| ???? |
3-Acetoxy-2-butanone |
| ?? ?? |
3-Acetoxy-2-butanone; Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone; 2-Acetoxyl-3-butanone |
| ??? |
C6H10O3 |
| ??? |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| cas?? |
4906-24-5 |
| ?? ?? |
|
| ?? |
1.012g/cm3 |
| ??? |
163.4°C at 760 mmHg |
| ?? ?? |
1.406 |
| ??? |
56.6°C |
| ??? |
2.07mmHg at 25°C |
| ??? ?? |
R36/38:Irritating to eyes and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|