5933-32-4 4-Bromobenzhydrazide
| ??? ????? |
4-Bromobenzhydrazide |
| ??? ??????? |
4-Bromobenzhydrazide; 4-Bromobenzoic hydrazide; 4-bromobenzohydrazide |
| ????? ???????? |
C7H7BrN2O |
| ??? ??????? |
215.0473 |
| InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| ????? ?????? |
5933-32-4 |
| ????? ??????? ??????? |
227-681-9 |
| ?????? ??????? |
|
| ????? |
1.615g/cm3 |
| ???? ??? |
165-167℃ |
| ???? ????? |
353.2°C at 760 mmHg |
| ???? ???? |
1.615 |
| ???? ?????? |
167.4°C |
| ???? ???? |
1.34E-05mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|