ChemNet > CAS > 13894-63-8 Methyl trans-2-hexenoate
13894-63-8 Methyl trans-2-hexenoate
| ?????? ?? ??? |
Methyl trans-2-hexenoate |
| ???????? ??? |
Methyl trans-2-hexenoate; 237-663-2; 2-Hexenoic acid, methyl ester, (E)-; 4U1VO1 & & E Form; Hex-2-enoic acid methyl ester, (E)-; Methyl (2E)-2-hexenoate; Methyl (2E)-hex-2-enoate; Methyl (E)-2-hexenoate |
| ????? ???????? |
C7H12O2 |
| ?????? ??? |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-4-5-6-7(8)9-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| ??? ??????? ?????? |
13894-63-8 |
| EINECS |
237-663-2 |
| ????? ?????? |
|
| ????? |
0.907g/cm3 |
| ????? ?? ??? |
149.3°C at 760 mmHg |
| ??????? ??????? |
1.427 |
| ????? ??????? |
45.4°C |
| ????? ?? ???? |
4.06mmHg at 25°C |
| ???? ?? ??? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|