ChemNet > CAS > 17028-61-4 2-Hydroxy-3-methoxy-5-nitrobenzaldehyde
17028-61-4 2-Hydroxy-3-methoxy-5-nitrobenzaldehyde
| ?? ????? |
2-Hydroxy-3-methoxy-5-nitrobenzaldehyde |
| ?? ????? |
2-Hydroxy-3-methoxy-5-nitrobenzaldehyde; 3-Methoxy-5-nitrosalicylaldehyde; 2-formyl-6-methoxy-4-nitrophenolate |
| ????????? ??????? |
C8H6NO5 |
| ???? ???????? |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-7-3-6(9(12)13)2-5(4-10)8(7)11/h2-4,11H,1H3/p-1 |
| ???? CAS |
17028-61-4 |
| ???? ???????? |
|
| ????? ????? |
140-142℃ |
| ????? ????? |
344°C at 760 mmHg |
| ????? ???? |
161.8°C |
| ??? ???? |
3.41E-05mmHg at 25°C |
| ??????? ???? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|