4964-71-0 5-Bromo-quinoline
| termék neve |
5-Bromo-quinoline |
| Angol név |
5-Bromo-quinoline; 5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
| MF |
C9H6BrN |
| Molekulat?meg |
208.0546 |
| InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| CAS-szám |
4964-71-0 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.564g/cm3 |
| Forráspont |
295.9°C at 760 mmHg |
| T?résmutató |
1.673 |
| Gyulladáspont |
132.8°C |
| G?znyomás |
0.00261mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|